About 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene
6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene (PubChem CID 177217180) has the molecular formula C13H17F2N3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene.
Molecular Properties
| Compound Name | 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene |
| PubChem CID | 177217180 |
| Molecular Formula | C13H17F2N3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene |
| SMILES | CC(C)Cc1cc(C#N)cnc1N.CC=C(F)F |
| InChI | InChI=1S/C10H13N3.C3H4F2/c1-7(2)3-9-4-8(5-11)6-13-10(9)12;1-2-3(4)5/h4,6-7H,3H2,1-2H3,(H2,12,13);2H,1H3 |
| InChIKey | CYYAJQHSUJRHJR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene?
The IUPAC name of 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene (CID 177217180) is 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene.
What is the SMILES notation for 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene?
The canonical SMILES for 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene is CC(C)Cc1cc(C#N)cnc1N.CC=C(F)F.
What is the InChIKey of 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene?
The InChIKey is CYYAJQHSUJRHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3.C3H4F2/c1-7(2)3-9-4-8(5-11)6-13-10(9)12;1-2-3(4)5/h4,6-7H,3H2,1-2H3,(H2,12,13);2H,1H3.
What are the key properties of 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene?
6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene has a molecular weight of 253.30 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-(2-methylpropyl)pyridine-3-carbonitrile;1,1-difluoroprop-1-ene is sourced from PubChem (CID 177217180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).