C13H10F7NO3 — CID 177217717
6-oxo-6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]hexanoic acid (PubChem CID 177217717) has the molecular formula C13H10F7NO3 and a molecular weight of 361.21 g/mol. Its IUPAC name is 6-oxo-6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]hexanoic acid.
| Compound Name | 6-oxo-6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]hexanoic acid |
|---|---|
| PubChem CID | 177217717 |
| Molecular Formula | C13H10F7NO3 |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 6-oxo-6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]hexanoic acid |
| SMILES | O=C(O)CCCCC(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H10F7NO3/c14-8-7(13(18,19)20)9(15)11(17)12(10(8)16)21-5(22)3-1-2-4-6(23)24/h1-4H2,(H,21,22)(H,23,24) |
| InChIKey | RDMYZFQLYUDVHM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|