C17H27NO4S — CID 177217721
7,7-dimethyl-6-[(4-methylphenyl)sulfonylamino]octanoic acid (PubChem CID 177217721) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is 7,7-dimethyl-6-[(4-methylphenyl)sulfonylamino]octanoic acid.
| Compound Name | 7,7-dimethyl-6-[(4-methylphenyl)sulfonylamino]octanoic acid |
|---|---|
| PubChem CID | 177217721 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 7,7-dimethyl-6-[(4-methylphenyl)sulfonylamino]octanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCCCC(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27NO4S/c1-13-9-11-14(12-10-13)23(21,22)18-15(17(2,3)4)7-5-6-8-16(19)20/h9-12,15,18H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | ZIXLTGLAXPIISS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|