C26H31F5N4O5 — CID 177218225
(2R,5S)-4-(3,4-difluoro-2-methoxyphenyl)-2,3,5-trimethyl-2-(trifluoromethyl)oxolane;4-formamido-6-(3-hydroxypyrrolidin-1-yl)pyridine-2-carboxamide (PubChem CID 177218225) has the molecular formula C26H31F5N4O5 and a molecular weight of 574.55 g/mol. Its IUPAC name is (2R,5S)-4-(3,4-difluoro-2-methoxyphenyl)-2,3,5-trimethyl-2-(trifluoromethyl)oxolane;4-formamido-6-(3-hydroxypyrrolidin-1-yl)pyridine-2-carboxamide.
| Compound Name | (2R,5S)-4-(3,4-difluoro-2-methoxyphenyl)-2,3,5-trimethyl-2-(trifluoromethyl)oxolane;4-formamido-6-(3-hydroxypyrrolidin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177218225 |
| Molecular Formula | C26H31F5N4O5 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | (2R,5S)-4-(3,4-difluoro-2-methoxyphenyl)-2,3,5-trimethyl-2-(trifluoromethyl)oxolane;4-formamido-6-(3-hydroxypyrrolidin-1-yl)pyridine-2-carboxamide |
| SMILES | COc1c(C2C(C)[C@](C)(C(F)(F)F)O[C@H]2C)ccc(F)c1F.NC(=O)c1cc(NC=O)cc(N2CCC(O)C2)n1 |
| InChI | InChI=1S/C15H17F5O2.C11H14N4O3/c1-7-11(8(2)22-14(7,3)15(18,19)20)9-5-6-10(16)12(17)13(9)21-4;12-11(18)9-3-7(13-6-16)4-10(14-9)15-2-1-8(17)5-15/h5-8,11H,1-4H3;3-4,6,8,17H,1-2,5H2,(H2,12,18)(H,13,14,16)/t7?,8-,11?,14+;/m0./s1 |
| InChIKey | ZFXLININCCYVTL-WFWBVZQVSA-N |
| XLogP | 3.75 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|