C21H22F5N5O3 — CID 177218327
(2R)-4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyl-2-(trifluoromethyl)oxolane;1H-imidazo[4,5-c]pyridine-4-carbohydrazide (PubChem CID 177218327) has the molecular formula C21H22F5N5O3 and a molecular weight of 487.43 g/mol. Its IUPAC name is (2R)-4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyl-2-(trifluoromethyl)oxolane;1H-imidazo[4,5-c]pyridine-4-carbohydrazide.
| Compound Name | (2R)-4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyl-2-(trifluoromethyl)oxolane;1H-imidazo[4,5-c]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 177218327 |
| Molecular Formula | C21H22F5N5O3 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (2R)-4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyl-2-(trifluoromethyl)oxolane;1H-imidazo[4,5-c]pyridine-4-carbohydrazide |
| SMILES | COc1c(C2CO[C@@](C)(C(F)(F)F)C2C)ccc(F)c1F.NNC(=O)c1nccc2[nH]cnc12 |
| InChI | InChI=1S/C14H15F5O2.C7H7N5O/c1-7-9(6-21-13(7,2)14(17,18)19)8-4-5-10(15)11(16)12(8)20-3;8-12-7(13)6-5-4(1-2-9-6)10-3-11-5/h4-5,7,9H,6H2,1-3H3;1-3H,8H2,(H,10,11)(H,12,13)/t7?,9?,13-;/m1./s1 |
| InChIKey | KPDBOBZFLMPUKS-LFKUHKJMSA-N |
| XLogP | 3.61 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|