C16H20F5NO4 — CID 177218381
(5R)-3-(3,4-difluoro-2-methoxyphenyl)-6,6,6-trifluoro-N,5-dihydroxy-N,4,5-trimethylhexanamide (PubChem CID 177218381) has the molecular formula C16H20F5NO4 and a molecular weight of 385.33 g/mol. Its IUPAC name is (5R)-3-(3,4-difluoro-2-methoxyphenyl)-6,6,6-trifluoro-N,5-dihydroxy-N,4,5-trimethylhexanamide.
| Compound Name | (5R)-3-(3,4-difluoro-2-methoxyphenyl)-6,6,6-trifluoro-N,5-dihydroxy-N,4,5-trimethylhexanamide |
|---|---|
| PubChem CID | 177218381 |
| Molecular Formula | C16H20F5NO4 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (5R)-3-(3,4-difluoro-2-methoxyphenyl)-6,6,6-trifluoro-N,5-dihydroxy-N,4,5-trimethylhexanamide |
| SMILES | COc1c(C(CC(=O)N(C)O)C(C)[C@@](C)(O)C(F)(F)F)ccc(F)c1F |
| InChI | InChI=1S/C16H20F5NO4/c1-8(15(2,24)16(19,20)21)10(7-12(23)22(3)25)9-5-6-11(17)13(18)14(9)26-4/h5-6,8,10,24-25H,7H2,1-4H3/t8?,10?,15-/m1/s1 |
| InChIKey | SDTVAPFNKSQICX-CCRXRLBGSA-N |
| XLogP | 3.24 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|