C26H31NO — CID 177218540
1-[4-[2-(2,3-dimethylphenyl)-2-(3-methyl-3,4-dihydropyridin-6-yl)ethyl]-2,6-dimethylphenyl]ethenol (PubChem CID 177218540) has the molecular formula C26H31NO and a molecular weight of 373.54 g/mol. Its IUPAC name is 1-[4-[2-(2,3-dimethylphenyl)-2-(3-methyl-3,4-dihydropyridin-6-yl)ethyl]-2,6-dimethylphenyl]ethenol.
| Compound Name | 1-[4-[2-(2,3-dimethylphenyl)-2-(3-methyl-3,4-dihydropyridin-6-yl)ethyl]-2,6-dimethylphenyl]ethenol |
|---|---|
| PubChem CID | 177218540 |
| Molecular Formula | C26H31NO |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-[4-[2-(2,3-dimethylphenyl)-2-(3-methyl-3,4-dihydropyridin-6-yl)ethyl]-2,6-dimethylphenyl]ethenol |
| SMILES | C=C(O)c1c(C)cc(CC(C2=CCC(C)C=N2)c2cccc(C)c2C)cc1C |
| InChI | InChI=1S/C26H31NO/c1-16-10-11-25(27-15-16)24(23-9-7-8-17(2)20(23)5)14-22-12-18(3)26(21(6)28)19(4)13-22/h7-9,11-13,15-16,24,28H,6,10,14H2,1-5H3 |
| InChIKey | YYVNWBYREGBCQF-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|