About carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium
carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium (PubChem CID 177218691) has the molecular formula C15H21FNOPd-
and a molecular weight of 356.76 g/mol. Its IUPAC name is carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium.
Molecular Properties
| Compound Name | carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium |
| PubChem CID | 177218691 |
| Molecular Formula | C15H21FNOPd- |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium |
| SMILES | C/C=C(\N=C\CC)C(O)c1cccc(F)c1C.[CH3-].[Pd] |
| InChI | InChI=1S/C14H18FNO.CH3.Pd/c1-4-9-16-13(5-2)14(17)11-7-6-8-12(15)10(11)3;;/h5-9,14,17H,4H2,1-3H3;1H3;/q;-1;/b13-5-,16-9+;; |
| InChIKey | BWGDKFDNISMADI-CMISQVOQSA-N |
| XLogP | 4.00 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium?
The IUPAC name of carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium (CID 177218691) is carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium.
What is the SMILES notation for carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium?
The canonical SMILES for carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium is C/C=C(\N=C\CC)C(O)c1cccc(F)c1C.[CH3-].[Pd].
What is the InChIKey of carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium?
The InChIKey is BWGDKFDNISMADI-CMISQVOQSA-N. The full InChI is InChI=1S/C14H18FNO.CH3.Pd/c1-4-9-16-13(5-2)14(17)11-7-6-8-12(15)10(11)3;;/h5-9,14,17H,4H2,1-3H3;1H3;/q;-1;/b13-5-,16-9+;;.
What are the key properties of carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium?
carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium has a molecular weight of 356.76 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(Z)-1-(3-fluoro-2-methylphenyl)-2-(propylideneamino)but-2-en-1-ol;palladium is sourced from PubChem (CID 177218691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).