About 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one
3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one (PubChem CID 177221157) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one |
| PubChem CID | 177221157 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one |
| SMILES | CC(C)c1ccc2c(c1)oc(=O)n2C(C)(C)C(C)C |
| InChI | InChI=1S/C16H23NO2/c1-10(2)12-7-8-13-14(9-12)19-15(18)17(13)16(5,6)11(3)4/h7-11H,1-6H3 |
| InChIKey | UWYXQIKLIOCDMC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one?
The IUPAC name of 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one (CID 177221157) is 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one?
The canonical SMILES for 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one is CC(C)c1ccc2c(c1)oc(=O)n2C(C)(C)C(C)C.
What is the InChIKey of 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one?
The InChIKey is UWYXQIKLIOCDMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-10(2)12-7-8-13-14(9-12)19-15(18)17(13)16(5,6)11(3)4/h7-11H,1-6H3.
What are the key properties of 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one?
3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one has a molecular weight of 261.37 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylbutan-2-yl)-6-propan-2-yl-1,3-benzoxazol-2-one is sourced from PubChem (CID 177221157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).