About 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one
1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one (PubChem CID 177221992) has the molecular formula C17H23FO2
and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one |
| PubChem CID | 177221992 |
| Molecular Formula | C17H23FO2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one |
| SMILES | CC(=O)c1ccc(F)cc1.CCC(=O)[C@@H]1CC[C@H](C)C1 |
| InChI | InChI=1S/C9H16O.C8H7FO/c1-3-9(10)8-5-4-7(2)6-8;1-6(10)7-2-4-8(9)5-3-7/h7-8H,3-6H2,1-2H3;2-5H,1H3/t7-,8+;/m0./s1 |
| InChIKey | GGJVJIHALUCRHN-KZYPOYLOSA-N |
| XLogP | 4.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one?
The IUPAC name of 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one (CID 177221992) is 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one.
What is the SMILES notation for 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one?
The canonical SMILES for 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one is CC(=O)c1ccc(F)cc1.CCC(=O)[C@@H]1CC[C@H](C)C1.
What is the InChIKey of 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one?
The InChIKey is GGJVJIHALUCRHN-KZYPOYLOSA-N. The full InChI is InChI=1S/C9H16O.C8H7FO/c1-3-9(10)8-5-4-7(2)6-8;1-6(10)7-2-4-8(9)5-3-7/h7-8H,3-6H2,1-2H3;2-5H,1H3/t7-,8+;/m0./s1.
What are the key properties of 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one?
1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one has a molecular weight of 278.37 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)ethanone;1-[(1R,3S)-3-methylcyclopentyl]propan-1-one is sourced from PubChem (CID 177221992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).