C30H36N6O2 — CID 177222188
CID 177222188 (PubChem CID 177222188) has the molecular formula C30H36N6O2 and a molecular weight of 512.66 g/mol.
| Compound Name | CID 177222188 |
|---|---|
| PubChem CID | 177222188 |
| Molecular Formula | C30H36N6O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | — |
| SMILES | CN(C)C(=O)c1ccc(CN2CCn3c(cnc3C(=O)NCc3ccc(N)cc3)C23CC2(CCC2)C3)cc1 |
| InChI | InChI=1S/C30H36N6O2/c1-34(2)28(38)23-8-4-22(5-9-23)18-35-14-15-36-25(30(35)19-29(20-30)12-3-13-29)17-32-26(36)27(37)33-16-21-6-10-24(31)11-7-21/h4-11,17H,3,12-16,18-20,31H2,1-2H3,(H,33,37) |
| InChIKey | LPGDUIXKFXFXIH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|