C13H23ClN4OS — CID 177223130
2-[(6-chloropyrazolo[3,4-b]pyrazin-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane;ethane (PubChem CID 177223130) has the molecular formula C13H23ClN4OS and a molecular weight of 318.87 g/mol. Its IUPAC name is 2-[(6-chloropyrazolo[3,4-b]pyrazin-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane;ethane.
| Compound Name | 2-[(6-chloropyrazolo[3,4-b]pyrazin-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane;ethane |
|---|---|
| PubChem CID | 177223130 |
| Molecular Formula | C13H23ClN4OS |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[(6-chloropyrazolo[3,4-b]pyrazin-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane;ethane |
| SMILES | CC.CS(C)(C)CCOCn1ncc2ncc(Cl)nc21 |
| InChI | InChI=1S/C11H17ClN4OS.C2H6/c1-18(2,3)5-4-17-8-16-11-9(6-14-16)13-7-10(12)15-11;1-2/h6-7H,4-5,8H2,1-3H3;1-2H3 |
| InChIKey | MFNNUHLEGWTIDJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|