About 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline
3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline (PubChem CID 177223273) has the molecular formula C16H26ClNO
and a molecular weight of 283.84 g/mol. Its IUPAC name is 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline.
Molecular Properties
| Compound Name | 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline |
| PubChem CID | 177223273 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline |
| SMILES | CCCCC(CCC)Oc1cc(NC)cc(Cl)c1C |
| InChI | InChI=1S/C16H26ClNO/c1-5-7-9-14(8-6-2)19-16-11-13(18-4)10-15(17)12(16)3/h10-11,14,18H,5-9H2,1-4H3 |
| InChIKey | WXMLRGOCLNIWPX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline?
The IUPAC name of 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline (CID 177223273) is 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline.
What is the SMILES notation for 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline?
The canonical SMILES for 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline is CCCCC(CCC)Oc1cc(NC)cc(Cl)c1C.
What is the InChIKey of 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline?
The InChIKey is WXMLRGOCLNIWPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26ClNO/c1-5-7-9-14(8-6-2)19-16-11-13(18-4)10-15(17)12(16)3/h10-11,14,18H,5-9H2,1-4H3.
What are the key properties of 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline?
3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline has a molecular weight of 283.84 g/mol, XLogP of 5.43, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,4-dimethyl-5-octan-4-yloxyaniline is sourced from PubChem (CID 177223273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).