C12H19NO — CID 177223338
3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-methylpyrrolidine (PubChem CID 177223338) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-methylpyrrolidine.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-methylpyrrolidine |
|---|---|
| PubChem CID | 177223338 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-1-methylpyrrolidine |
| SMILES | C=C/C(=C\C=C/C)OC1CCN(C)C1 |
| InChI | InChI=1S/C12H19NO/c1-4-6-7-11(5-2)14-12-8-9-13(3)10-12/h4-7,12H,2,8-10H2,1,3H3/b6-4-,11-7+ |
| InChIKey | HMZMGVSUQZZVIO-WXVRQDIQSA-N |
| XLogP | 2.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|