C13H21F2N3 — CID 177223368
6-(3,3-difluoropiperidin-1-yl)-N-methylpyridin-3-amine;ethane (PubChem CID 177223368) has the molecular formula C13H21F2N3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 6-(3,3-difluoropiperidin-1-yl)-N-methylpyridin-3-amine;ethane.
| Compound Name | 6-(3,3-difluoropiperidin-1-yl)-N-methylpyridin-3-amine;ethane |
|---|---|
| PubChem CID | 177223368 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 6-(3,3-difluoropiperidin-1-yl)-N-methylpyridin-3-amine;ethane |
| SMILES | CC.CNc1ccc(N2CCCC(F)(F)C2)nc1 |
| InChI | InChI=1S/C11H15F2N3.C2H6/c1-14-9-3-4-10(15-7-9)16-6-2-5-11(12,13)8-16;1-2/h3-4,7,14H,2,5-6,8H2,1H3;1-2H3 |
| InChIKey | WYGHIGMOUXTBTK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |