C22H21N3O5 — CID 177223415
(3S)-11-hydroxy-13-[(1S)-1-naphthalen-2-ylethoxy]-5-oxa-1,8,14-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 177223415) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is (3S)-11-hydroxy-13-[(1S)-1-naphthalen-2-ylethoxy]-5-oxa-1,8,14-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3S)-11-hydroxy-13-[(1S)-1-naphthalen-2-ylethoxy]-5-oxa-1,8,14-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 177223415 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (3S)-11-hydroxy-13-[(1S)-1-naphthalen-2-ylethoxy]-5-oxa-1,8,14-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | C[C@H](Oc1nn2c(c(O)c1=O)C(=O)N1CCOC[C@@H]1C2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H21N3O5/c1-13(15-7-6-14-4-2-3-5-16(14)10-15)30-21-20(27)19(26)18-22(28)24-8-9-29-12-17(24)11-25(18)23-21/h2-7,10,13,17,26H,8-9,11-12H2,1H3/t13-,17-/m0/s1 |
| InChIKey | RSNRUPAULQXTNA-GUYCJALGSA-N |
| XLogP | 2.10 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |