About 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol
4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol (PubChem CID 177225210) has the molecular formula C13H28NO5+
and a molecular weight of 278.37 g/mol. Its IUPAC name is 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol.
Molecular Properties
| Compound Name | 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol |
| PubChem CID | 177225210 |
| Molecular Formula | C13H28NO5+ |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol |
| SMILES | CC.CO.C[N+]1(C)CCC(OC(=O)CCC(=O)O)C1 |
| InChI | InChI=1S/C10H17NO4.C2H6.CH4O/c1-11(2)6-5-8(7-11)15-10(14)4-3-9(12)13;2*1-2/h8H,3-7H2,1-2H3;1-2H3;2H,1H3/p+1 |
| InChIKey | GSUTUQKCFGHZQI-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol?
The IUPAC name of 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol (CID 177225210) is 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol.
What is the SMILES notation for 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol?
The canonical SMILES for 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol is CC.CO.C[N+]1(C)CCC(OC(=O)CCC(=O)O)C1.
What is the InChIKey of 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol?
The InChIKey is GSUTUQKCFGHZQI-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H17NO4.C2H6.CH4O/c1-11(2)6-5-8(7-11)15-10(14)4-3-9(12)13;2*1-2/h8H,3-7H2,1-2H3;1-2H3;2H,1H3/p+1.
What are the key properties of 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol?
4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol has a molecular weight of 278.37 g/mol, XLogP of 0.88, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-4-oxobutanoic acid;ethane;methanol is sourced from PubChem (CID 177225210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).