C33H66N2O2S — CID 177225459
3,4-dimethyltetradecan-6-one;ethane;hexyl (E,2Z)-3-ethyl-2-sulfanyliminohept-3-enimidate (PubChem CID 177225459) has the molecular formula C33H66N2O2S and a molecular weight of 554.97 g/mol. Its IUPAC name is 3,4-dimethyltetradecan-6-one;ethane;hexyl (E,2Z)-3-ethyl-2-sulfanyliminohept-3-enimidate.
| Compound Name | 3,4-dimethyltetradecan-6-one;ethane;hexyl (E,2Z)-3-ethyl-2-sulfanyliminohept-3-enimidate |
|---|---|
| PubChem CID | 177225459 |
| Molecular Formula | C33H66N2O2S |
| Molecular Weight | 554.97 g/mol |
| Exact Mass | 554.48 |
| IUPAC Name | 3,4-dimethyltetradecan-6-one;ethane;hexyl (E,2Z)-3-ethyl-2-sulfanyliminohept-3-enimidate |
| SMILES | CC.CCCCCCCCC(=O)CC(C)C(C)CC.[H]/N=C(OCCCCCC)/C(=N\S)C(=C/CCC)/CC |
| InChI | InChI=1S/C16H32O.C15H28N2OS.C2H6/c1-5-7-8-9-10-11-12-16(17)13-15(4)14(3)6-2;1-4-7-9-10-12-18-15(16)14(17-19)13(6-3)11-8-5-2;1-2/h14-15H,5-13H2,1-4H3;11,16,19H,4-10,12H2,1-3H3;1-2H3/b;13-11+,16-15-,17-14-; |
| InChIKey | MIGPKVHPNDGAIV-XVJCEMQTSA-N |
| XLogP | 11.39 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.97 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|