About 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole
6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole (PubChem CID 177227339) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole.
Analyze 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
The IUPAC name of 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole (CID 177227339) is 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole.
What is the SMILES notation for 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
The canonical SMILES for 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole is CCC1Cc2nncn2C1.
What is the InChIKey of 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
The InChIKey is GCLGMROWVHKTSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-2-6-3-7-9-8-5-10(7)4-6/h5-6H,2-4H2,1H3.
What are the key properties of 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole has a molecular weight of 137.19 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole is sourced from PubChem (CID 177227339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).