About CID 177227888
CID 177227888 (PubChem CID 177227888) has the molecular formula C25H27N3O2Si
and a molecular weight of 429.60 g/mol.
Molecular Properties
| Compound Name | CID 177227888 |
| PubChem CID | 177227888 |
| Molecular Formula | C25H27N3O2Si |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | — |
| SMILES | C[Si][C@H](O)c1nccn1[C@@H](C#Cc1ccc(-c2ccc(CC3CNC3)cc2)cc1)CO |
| InChI | InChI=1S/C25H27N3O2Si/c1-31-25(30)24-27-12-13-28(24)23(17-29)11-6-18-2-7-21(8-3-18)22-9-4-19(5-10-22)14-20-15-26-16-20/h2-5,7-10,12-13,20,23,25-26,29-30H,14-17H2,1H3/t23-,25-/m0/s1 |
| InChIKey | ZOEWSEFIYFWBQO-ZCYQVOJMSA-N |
| XLogP | 2.64 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 177227888 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177227888?
The IUPAC name of CID 177227888 (CID 177227888) is not available.
What is the SMILES notation for CID 177227888?
The canonical SMILES for CID 177227888 is C[Si][C@H](O)c1nccn1[C@@H](C#Cc1ccc(-c2ccc(CC3CNC3)cc2)cc1)CO.
What is the InChIKey of CID 177227888?
The InChIKey is ZOEWSEFIYFWBQO-ZCYQVOJMSA-N. The full InChI is InChI=1S/C25H27N3O2Si/c1-31-25(30)24-27-12-13-28(24)23(17-29)11-6-18-2-7-21(8-3-18)22-9-4-19(5-10-22)14-20-15-26-16-20/h2-5,7-10,12-13,20,23,25-26,29-30H,14-17H2,1H3/t23-,25-/m0/s1.
What are the key properties of CID 177227888?
CID 177227888 has a molecular weight of 429.60 g/mol, XLogP of 2.64, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177227888 is sourced from PubChem (CID 177227888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).