About CID 177228116
CID 177228116 (PubChem CID 177228116) has the molecular formula C26H28N2O8PSi
and a molecular weight of 555.58 g/mol.
Molecular Properties
| Compound Name | CID 177228116 |
| PubChem CID | 177228116 |
| Molecular Formula | C26H28N2O8PSi |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2ccc(C#C[C@@H](COP(=O)(O)O)n3ccnc3[C@@](C)(O)[Si])cc2)ccc1O[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C26H28N2O8PSi/c1-17-13-20(8-10-23(17)36-24-16-34-15-22(24)29)19-6-3-18(4-7-19)5-9-21(14-35-37(31,32)33)28-12-11-27-25(28)26(2,30)38/h3-4,6-8,10-13,21-22,24,29-30H,14-16H2,1-2H3,(H2,31,32,33)/t21-,22+,24+,26-/m0/s1 |
| InChIKey | XQKDYXNYHAHRBS-UBRJVWORSA-N |
| XLogP | 2.03 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 177228116 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177228116?
The IUPAC name of CID 177228116 (CID 177228116) is not available.
What is the SMILES notation for CID 177228116?
The canonical SMILES for CID 177228116 is Cc1cc(-c2ccc(C#C[C@@H](COP(=O)(O)O)n3ccnc3[C@@](C)(O)[Si])cc2)ccc1O[C@@H]1COC[C@H]1O.
What is the InChIKey of CID 177228116?
The InChIKey is XQKDYXNYHAHRBS-UBRJVWORSA-N. The full InChI is InChI=1S/C26H28N2O8PSi/c1-17-13-20(8-10-23(17)36-24-16-34-15-22(24)29)19-6-3-18(4-7-19)5-9-21(14-35-37(31,32)33)28-12-11-27-25(28)26(2,30)38/h3-4,6-8,10-13,21-22,24,29-30H,14-16H2,1-2H3,(H2,31,32,33)/t21-,22+,24+,26-/m0/s1.
What are the key properties of CID 177228116?
CID 177228116 has a molecular weight of 555.58 g/mol, XLogP of 2.03, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177228116 is sourced from PubChem (CID 177228116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).