C23H22N3O6P — CID 177228127
[(2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-(2-oxo-1,3-dihydroindol-6-yl)phenyl]but-3-ynyl] dihydrogen phosphate (PubChem CID 177228127) has the molecular formula C23H22N3O6P and a molecular weight of 467.42 g/mol. Its IUPAC name is [(2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-(2-oxo-1,3-dihydroindol-6-yl)phenyl]but-3-ynyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-(2-oxo-1,3-dihydroindol-6-yl)phenyl]but-3-ynyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 177228127 |
| Molecular Formula | C23H22N3O6P |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [(2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-(2-oxo-1,3-dihydroindol-6-yl)phenyl]but-3-ynyl] dihydrogen phosphate |
| SMILES | C[C@H](O)c1nccn1[C@@H](C#Cc1ccc(-c2ccc3c(c2)NC(=O)C3)cc1)COP(=O)(O)O |
| InChI | InChI=1S/C23H22N3O6P/c1-15(27)23-24-10-11-26(23)20(14-32-33(29,30)31)9-4-16-2-5-17(6-3-16)18-7-8-19-13-22(28)25-21(19)12-18/h2-3,5-8,10-12,15,20,27H,13-14H2,1H3,(H,25,28)(H2,29,30,31)/t15-,20-/m0/s1 |
| InChIKey | SBMVSSKSNQUSLG-YWZLYKJASA-N |
| XLogP | 2.80 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|