C17H28N2O6 — CID 177228402
acetyloxymethyl (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 177228402) has the molecular formula C17H28N2O6 and a molecular weight of 356.42 g/mol. Its IUPAC name is acetyloxymethyl (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | acetyloxymethyl (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 177228402 |
| Molecular Formula | C17H28N2O6 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | acetyloxymethyl (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)OCOC(C)=O)C[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H28N2O6/c1-5-13(6-2)25-15-8-12(17(22)24-9-23-11(4)21)7-14(18)16(15)19-10(3)20/h8,13-16H,5-7,9,18H2,1-4H3,(H,19,20)/t14-,15+,16+/m0/s1 |
| InChIKey | XICCSZFDBXSXON-ARFHVFGLSA-N |
| XLogP | 0.79 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|