C32H38N4O6 — CID 177228731
(13S)-11-[5-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethyl-methylamino]ethoxy]-1H-indole-2-carbonyl]-3-methyl-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraen-8-one (PubChem CID 177228731) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is (13S)-11-[5-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethyl-methylamino]ethoxy]-1H-indole-2-carbonyl]-3-methyl-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraen-8-one.
| Compound Name | (13S)-11-[5-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethyl-methylamino]ethoxy]-1H-indole-2-carbonyl]-3-methyl-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraen-8-one |
|---|---|
| PubChem CID | 177228731 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (13S)-11-[5-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethyl-methylamino]ethoxy]-1H-indole-2-carbonyl]-3-methyl-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraen-8-one |
| SMILES | Cc1cccc2c1C13C[C@@H]1CN(C(=O)c1cc4cc(OCCN(C)CCOCCOCCON)ccc4[nH]1)C3=CC2=O |
| InChI | InChI=1S/C32H38N4O6/c1-21-4-3-5-25-28(37)18-29-32(30(21)25)19-23(32)20-36(29)31(38)27-17-22-16-24(6-7-26(22)34-27)41-11-9-35(2)8-10-39-12-13-40-14-15-42-33/h3-7,16-18,23,34H,8-15,19-20,33H2,1-2H3/t23-,32?/m1/s1 |
| InChIKey | UDUXWLOFTSYSFW-IYOGPWPASA-N |
| XLogP | 3.20 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|