About 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane
4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane (PubChem CID 177229887) has the molecular formula C16H27ClN4OS
and a molecular weight of 358.94 g/mol. Its IUPAC name is 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane.
Molecular Properties
| Compound Name | 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane |
| PubChem CID | 177229887 |
| Molecular Formula | C16H27ClN4OS |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane |
| SMILES | CC.CC.Clc1csc(-c2cnn(CCN3CCOCC3)c2)n1 |
| InChI | InChI=1S/C12H15ClN4OS.2C2H6/c13-11-9-19-12(15-11)10-7-14-17(8-10)2-1-16-3-5-18-6-4-16;2*1-2/h7-9H,1-6H2;2*1-2H3 |
| InChIKey | VXCZWWYKRSJALT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane?
The IUPAC name of 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane (CID 177229887) is 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane.
What is the SMILES notation for 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane?
The canonical SMILES for 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane is CC.CC.Clc1csc(-c2cnn(CCN3CCOCC3)c2)n1.
What is the InChIKey of 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane?
The InChIKey is VXCZWWYKRSJALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN4OS.2C2H6/c13-11-9-19-12(15-11)10-7-14-17(8-10)2-1-16-3-5-18-6-4-16;2*1-2/h7-9H,1-6H2;2*1-2H3.
What are the key properties of 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane?
4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane has a molecular weight of 358.94 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]ethyl]morpholine;ethane is sourced from PubChem (CID 177229887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).