About 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane
4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane (PubChem CID 177229893) has the molecular formula C10H14ClNOS
and a molecular weight of 231.75 g/mol. Its IUPAC name is 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane.
Molecular Properties
| Compound Name | 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane |
| PubChem CID | 177229893 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane |
| SMILES | CC.Clc1csc(C2=CCOCC2)n1 |
| InChI | InChI=1S/C8H8ClNOS.C2H6/c9-7-5-12-8(10-7)6-1-3-11-4-2-6;1-2/h1,5H,2-4H2;1-2H3 |
| InChIKey | YTRXBSRAQLSUKC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane?
The IUPAC name of 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane (CID 177229893) is 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane.
What is the SMILES notation for 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane?
The canonical SMILES for 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane is CC.Clc1csc(C2=CCOCC2)n1.
What is the InChIKey of 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane?
The InChIKey is YTRXBSRAQLSUKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNOS.C2H6/c9-7-5-12-8(10-7)6-1-3-11-4-2-6;1-2/h1,5H,2-4H2;1-2H3.
What are the key properties of 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane?
4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane has a molecular weight of 231.75 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazole;ethane is sourced from PubChem (CID 177229893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).