C7H11N3O2S — CID 177229903
2,4-dimethyl-3H-1,3-thiazole-2,5-dicarboxamide (PubChem CID 177229903) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2,4-dimethyl-3H-1,3-thiazole-2,5-dicarboxamide.
| Compound Name | 2,4-dimethyl-3H-1,3-thiazole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 177229903 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2,4-dimethyl-3H-1,3-thiazole-2,5-dicarboxamide |
| SMILES | CC1=C(C(N)=O)SC(C)(C(N)=O)N1 |
| InChI | InChI=1S/C7H11N3O2S/c1-3-4(5(8)11)13-7(2,10-3)6(9)12/h10H,1-2H3,(H2,8,11)(H2,9,12) |
| InChIKey | POVXUEXQIWOOAR-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |