About 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane
4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane (PubChem CID 177229937) has the molecular formula C11H21ClN2OS
and a molecular weight of 264.82 g/mol. Its IUPAC name is 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane.
Molecular Properties
| Compound Name | 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane |
| PubChem CID | 177229937 |
| Molecular Formula | C11H21ClN2OS |
| Molecular Weight | 264.82 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane |
| SMILES | CC.CC.CC(C)NC(=O)c1nc(Cl)cs1 |
| InChI | InChI=1S/C7H9ClN2OS.2C2H6/c1-4(2)9-6(11)7-10-5(8)3-12-7;2*1-2/h3-4H,1-2H3,(H,9,11);2*1-2H3 |
| InChIKey | SMUQXRSHGRUGCV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane?
The IUPAC name of 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane (CID 177229937) is 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane.
What is the SMILES notation for 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane?
The canonical SMILES for 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane is CC.CC.CC(C)NC(=O)c1nc(Cl)cs1.
What is the InChIKey of 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane?
The InChIKey is SMUQXRSHGRUGCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2OS.2C2H6/c1-4(2)9-6(11)7-10-5(8)3-12-7;2*1-2/h3-4H,1-2H3,(H,9,11);2*1-2H3.
What are the key properties of 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane?
4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane has a molecular weight of 264.82 g/mol, XLogP of 3.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-propan-2-yl-1,3-thiazole-2-carboxamide;ethane is sourced from PubChem (CID 177229937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).