About (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one
(3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one (PubChem CID 17723) has the molecular formula C5H8O5
and a molecular weight of 148.11 g/mol. Its IUPAC name is (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one.
Analyze (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one?
The IUPAC name of (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one (CID 17723) is (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one.
What is the SMILES notation for (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one?
The canonical SMILES for (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one is O=C1O[C@H](CO)[C@@H](O)[C@@H]1O.
What is the InChIKey of (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one?
The InChIKey is CUOKHACJLGPRHD-JJYYJPOSSA-N. The full InChI is InChI=1S/C5H8O5/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2-,3-,4+/m1/s1.
What are the key properties of (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one?
(3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one has a molecular weight of 148.11 g/mol, XLogP of -2.37, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one is sourced from PubChem (CID 17723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).