About 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one
3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one (PubChem CID 177230465) has the molecular formula C9H17FN2O
and a molecular weight of 188.25 g/mol. Its IUPAC name is 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one.
Molecular Properties
| Compound Name | 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one |
| PubChem CID | 177230465 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one |
| SMILES | C/C=C/C(C)=O.NC1(F)CCNC1 |
| InChI | InChI=1S/C5H8O.C4H9FN2/c1-3-4-5(2)6;5-4(6)1-2-7-3-4/h3-4H,1-2H3;7H,1-3,6H2/b4-3+; |
| InChIKey | JATDZNIEQMLLBH-BJILWQEISA-N |
| XLogP | 0.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one?
The IUPAC name of 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one (CID 177230465) is 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one.
What is the SMILES notation for 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one?
The canonical SMILES for 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one is C/C=C/C(C)=O.NC1(F)CCNC1.
What is the InChIKey of 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one?
The InChIKey is JATDZNIEQMLLBH-BJILWQEISA-N. The full InChI is InChI=1S/C5H8O.C4H9FN2/c1-3-4-5(2)6;5-4(6)1-2-7-3-4/h3-4H,1-2H3;7H,1-3,6H2/b4-3+;.
What are the key properties of 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one?
3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one has a molecular weight of 188.25 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropyrrolidin-3-amine;(E)-pent-3-en-2-one is sourced from PubChem (CID 177230465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).