About (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one
(E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one (PubChem CID 177230574) has the molecular formula C12H18F3NO
and a molecular weight of 249.28 g/mol. Its IUPAC name is (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one.
Molecular Properties
| Compound Name | (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one |
| PubChem CID | 177230574 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one |
| SMILES | CC(=O)/C=C/CC1CCCN1CCC(F)(F)F |
| InChI | InChI=1S/C12H18F3NO/c1-10(17)4-2-5-11-6-3-8-16(11)9-7-12(13,14)15/h2,4,11H,3,5-9H2,1H3/b4-2+ |
| InChIKey | ARODIRGMAZJVPX-DUXPYHPUSA-N |
| XLogP | 2.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one?
The IUPAC name of (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one (CID 177230574) is (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one.
What is the SMILES notation for (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one?
The canonical SMILES for (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one is CC(=O)/C=C/CC1CCCN1CCC(F)(F)F.
What is the InChIKey of (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one?
The InChIKey is ARODIRGMAZJVPX-DUXPYHPUSA-N. The full InChI is InChI=1S/C12H18F3NO/c1-10(17)4-2-5-11-6-3-8-16(11)9-7-12(13,14)15/h2,4,11H,3,5-9H2,1H3/b4-2+.
What are the key properties of (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one?
(E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one has a molecular weight of 249.28 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-[1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]pent-3-en-2-one is sourced from PubChem (CID 177230574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).