About ethane;1-ethenyl-2-ethynyl-4-fluorobenzene
ethane;1-ethenyl-2-ethynyl-4-fluorobenzene (PubChem CID 177230822) has the molecular formula C12H13F
and a molecular weight of 176.23 g/mol. Its IUPAC name is ethane;1-ethenyl-2-ethynyl-4-fluorobenzene.
Molecular Properties
| Compound Name | ethane;1-ethenyl-2-ethynyl-4-fluorobenzene |
| PubChem CID | 177230822 |
| Molecular Formula | C12H13F |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | ethane;1-ethenyl-2-ethynyl-4-fluorobenzene |
| SMILES | C#Cc1cc(F)ccc1C=C.CC |
| InChI | InChI=1S/C10H7F.C2H6/c1-3-8-5-6-10(11)7-9(8)4-2;1-2/h2-3,5-7H,1H2;1-2H3 |
| InChIKey | UDOZNSBRUYCZAO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethenyl-2-ethynyl-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenyl-2-ethynyl-4-fluorobenzene?
The IUPAC name of ethane;1-ethenyl-2-ethynyl-4-fluorobenzene (CID 177230822) is ethane;1-ethenyl-2-ethynyl-4-fluorobenzene.
What is the SMILES notation for ethane;1-ethenyl-2-ethynyl-4-fluorobenzene?
The canonical SMILES for ethane;1-ethenyl-2-ethynyl-4-fluorobenzene is C#Cc1cc(F)ccc1C=C.CC.
What is the InChIKey of ethane;1-ethenyl-2-ethynyl-4-fluorobenzene?
The InChIKey is UDOZNSBRUYCZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F.C2H6/c1-3-8-5-6-10(11)7-9(8)4-2;1-2/h2-3,5-7H,1H2;1-2H3.
What are the key properties of ethane;1-ethenyl-2-ethynyl-4-fluorobenzene?
ethane;1-ethenyl-2-ethynyl-4-fluorobenzene has a molecular weight of 176.23 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenyl-2-ethynyl-4-fluorobenzene is sourced from PubChem (CID 177230822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).