C10H17NS — CID 177231201
(3S)-1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine-3-thiol (PubChem CID 177231201) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is (3S)-1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine-3-thiol.
| Compound Name | (3S)-1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine-3-thiol |
|---|---|
| PubChem CID | 177231201 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (3S)-1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine-3-thiol |
| SMILES | C=C(C)/C=C/CN1CC[C@H](S)C1 |
| InChI | InChI=1S/C10H17NS/c1-9(2)4-3-6-11-7-5-10(12)8-11/h3-4,10,12H,1,5-8H2,2H3/b4-3+/t10-/m0/s1 |
| InChIKey | RFUFKZUFJHAOJX-FSIBCCDJSA-N |
| XLogP | 2.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|