C8H11N3O — CID 177231303
8-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-3-carbaldehyde (PubChem CID 177231303) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 8-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-3-carbaldehyde.
| Compound Name | 8-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-3-carbaldehyde |
|---|---|
| PubChem CID | 177231303 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 8-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-3-carbaldehyde |
| SMILES | CC1NCCn2c(C=O)cnc21 |
| InChI | InChI=1S/C8H11N3O/c1-6-8-10-4-7(5-12)11(8)3-2-9-6/h4-6,9H,2-3H2,1H3 |
| InChIKey | CUYAQXGXYGATHK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|