About 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene
3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene (PubChem CID 177231768) has the molecular formula C13H23F2N
and a molecular weight of 231.33 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene |
| PubChem CID | 177231768 |
| Molecular Formula | C13H23F2N |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene |
| SMILES | C=C.C=C/C=C/CN1CC(C(F)F)C1.CC |
| InChI | InChI=1S/C9H13F2N.C2H6.C2H4/c1-2-3-4-5-12-6-8(7-12)9(10)11;2*1-2/h2-4,8-9H,1,5-7H2;1-2H3;1-2H2/b4-3+;; |
| InChIKey | DDMIPXBASPPELC-CZEFNJPISA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene?
The IUPAC name of 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene (CID 177231768) is 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene.
What is the SMILES notation for 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene?
The canonical SMILES for 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene is C=C.C=C/C=C/CN1CC(C(F)F)C1.CC.
What is the InChIKey of 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene?
The InChIKey is DDMIPXBASPPELC-CZEFNJPISA-N. The full InChI is InChI=1S/C9H13F2N.C2H6.C2H4/c1-2-3-4-5-12-6-8(7-12)9(10)11;2*1-2/h2-4,8-9H,1,5-7H2;1-2H3;1-2H2/b4-3+;;.
What are the key properties of 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene?
3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene has a molecular weight of 231.33 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-1-[(2E)-penta-2,4-dienyl]azetidine;ethane;ethene is sourced from PubChem (CID 177231768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).