C22H30ClN5O2 — CID 177231797
N-(2-chlorophenyl)-7-formyl-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;(E)-N-ethyl-N-methylbut-2-en-1-amine (PubChem CID 177231797) has the molecular formula C22H30ClN5O2 and a molecular weight of 431.97 g/mol. Its IUPAC name is N-(2-chlorophenyl)-7-formyl-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;(E)-N-ethyl-N-methylbut-2-en-1-amine.
| Compound Name | N-(2-chlorophenyl)-7-formyl-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;(E)-N-ethyl-N-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 177231797 |
| Molecular Formula | C22H30ClN5O2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-(2-chlorophenyl)-7-formyl-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;(E)-N-ethyl-N-methylbut-2-en-1-amine |
| SMILES | C/C=C/CN(C)CC.CC1c2ncc(C(=O)Nc3ccccc3Cl)n2CCN1C=O |
| InChI | InChI=1S/C15H15ClN4O2.C7H15N/c1-10-14-17-8-13(20(14)7-6-19(10)9-21)15(22)18-12-5-3-2-4-11(12)16;1-4-6-7-8(3)5-2/h2-5,8-10H,6-7H2,1H3,(H,18,22);4,6H,5,7H2,1-3H3/b;6-4+ |
| InChIKey | MNCIWHDUTYEIER-DVXCEAISSA-N |
| XLogP | 3.84 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|