C10H17NS — CID 177231949
4-[(2E)-4-methylpenta-2,4-dienyl]thiomorpholine (PubChem CID 177231949) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is 4-[(2E)-4-methylpenta-2,4-dienyl]thiomorpholine.
| Compound Name | 4-[(2E)-4-methylpenta-2,4-dienyl]thiomorpholine |
|---|---|
| PubChem CID | 177231949 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 4-[(2E)-4-methylpenta-2,4-dienyl]thiomorpholine |
| SMILES | C=C(C)/C=C/CN1CCSCC1 |
| InChI | InChI=1S/C10H17NS/c1-10(2)4-3-5-11-6-8-12-9-7-11/h3-4H,1,5-9H2,2H3/b4-3+ |
| InChIKey | YRTXUEDTNOBJDV-ONEGZZNKSA-N |
| XLogP | 2.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|