About ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole
ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole (PubChem CID 177232143) has the molecular formula C18H33N
and a molecular weight of 263.47 g/mol. Its IUPAC name is ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole.
Molecular Properties
| Compound Name | ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole |
| PubChem CID | 177232143 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole |
| SMILES | C=C/C(C)=C\n1cc(C)cc1C=C.CC.CC.CC |
| InChI | InChI=1S/C12H15N.3C2H6/c1-5-10(3)8-13-9-11(4)7-12(13)6-2;3*1-2/h5-9H,1-2H2,3-4H3;3*1-2H3/b10-8-;;; |
| InChIKey | VCMCFRCMUBLNMS-MWHRLNGWSA-N |
| XLogP | 6.56 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole?
The IUPAC name of ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole (CID 177232143) is ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole.
What is the SMILES notation for ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole?
The canonical SMILES for ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole is C=C/C(C)=C\n1cc(C)cc1C=C.CC.CC.CC.
What is the InChIKey of ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole?
The InChIKey is VCMCFRCMUBLNMS-MWHRLNGWSA-N. The full InChI is InChI=1S/C12H15N.3C2H6/c1-5-10(3)8-13-9-11(4)7-12(13)6-2;3*1-2/h5-9H,1-2H2,3-4H3;3*1-2H3/b10-8-;;;.
What are the key properties of ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole?
ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole has a molecular weight of 263.47 g/mol, XLogP of 6.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethenyl-4-methyl-1-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole is sourced from PubChem (CID 177232143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).