About N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine
N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine (PubChem CID 177232538) has the molecular formula C8H17FIN
and a molecular weight of 273.13 g/mol. Its IUPAC name is N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine |
| PubChem CID | 177232538 |
| Molecular Formula | C8H17FIN |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine |
| SMILES | C/C=I/CN(CC)CCCF |
| InChI | InChI=1S/C8H17FIN/c1-3-10-8-11(4-2)7-5-6-9/h3H,4-8H2,1-2H3 |
| InChIKey | IRNBQLHVGTULPI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine?
The IUPAC name of N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine (CID 177232538) is N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine.
What is the SMILES notation for N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine?
The canonical SMILES for N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine is C/C=I/CN(CC)CCCF.
What is the InChIKey of N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine?
The InChIKey is IRNBQLHVGTULPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17FIN/c1-3-10-8-11(4-2)7-5-6-9/h3H,4-8H2,1-2H3.
What are the key properties of N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine?
N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine has a molecular weight of 273.13 g/mol, XLogP of 2.42, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[(ethylidene-λ3-iodanyl)methyl]-3-fluoropropan-1-amine is sourced from PubChem (CID 177232538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).