C21H34BNO4 — CID 177232667
but-1-ene;ethyl (E)-2-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-1-yl]prop-2-enoate (PubChem CID 177232667) has the molecular formula C21H34BNO4 and a molecular weight of 375.32 g/mol. Its IUPAC name is but-1-ene;ethyl (E)-2-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-1-yl]prop-2-enoate.
| Compound Name | but-1-ene;ethyl (E)-2-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 177232667 |
| Molecular Formula | C21H34BNO4 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | but-1-ene;ethyl (E)-2-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-1-yl]prop-2-enoate |
| SMILES | C=CCC.CCOC(=O)/C(C)=C/N1C=CC(B2OC(C)(C)C(C)(C)O2)=CC1 |
| InChI | InChI=1S/C17H26BNO4.C4H8/c1-7-21-15(20)13(2)12-19-10-8-14(9-11-19)18-22-16(3,4)17(5,6)23-18;1-3-4-2/h8-10,12H,7,11H2,1-6H3;3H,1,4H2,2H3/b13-12+; |
| InChIKey | BPSRPMRWWGRAHL-UEIGIMKUSA-N |
| XLogP | 4.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|