About 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine
2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine (PubChem CID 177233568) has the molecular formula C9H9ClF2N2O
and a molecular weight of 234.63 g/mol. Its IUPAC name is 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine |
| PubChem CID | 177233568 |
| Molecular Formula | C9H9ClF2N2O |
| Molecular Weight | 234.63 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine |
| SMILES | Nc1ccnc(Cl)c1OC1CC(F)(F)C1 |
| InChI | InChI=1S/C9H9ClF2N2O/c10-8-7(6(13)1-2-14-8)15-5-3-9(11,12)4-5/h1-2,5H,3-4H2,(H2,13,14) |
| InChIKey | HUECINHDNCHWRE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine?
The IUPAC name of 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine (CID 177233568) is 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine.
What is the SMILES notation for 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine?
The canonical SMILES for 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine is Nc1ccnc(Cl)c1OC1CC(F)(F)C1.
What is the InChIKey of 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine?
The InChIKey is HUECINHDNCHWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClF2N2O/c10-8-7(6(13)1-2-14-8)15-5-3-9(11,12)4-5/h1-2,5H,3-4H2,(H2,13,14).
What are the key properties of 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine?
2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine has a molecular weight of 234.63 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(3,3-difluorocyclobutyl)oxypyridin-4-amine is sourced from PubChem (CID 177233568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).