About 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine
4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine (PubChem CID 177233603) has the molecular formula C13H15ClF2N2O2
and a molecular weight of 304.72 g/mol. Its IUPAC name is 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine |
| PubChem CID | 177233603 |
| Molecular Formula | C13H15ClF2N2O2 |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine |
| SMILES | FC1(F)CC(Oc2c(N3CCOCC3)ccnc2Cl)C1 |
| InChI | InChI=1S/C13H15ClF2N2O2/c14-12-11(20-9-7-13(15,16)8-9)10(1-2-17-12)18-3-5-19-6-4-18/h1-2,9H,3-8H2 |
| InChIKey | MRUBJYTYJFQXHI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine?
The IUPAC name of 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine (CID 177233603) is 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine.
What is the SMILES notation for 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine?
The canonical SMILES for 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine is FC1(F)CC(Oc2c(N3CCOCC3)ccnc2Cl)C1.
What is the InChIKey of 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine?
The InChIKey is MRUBJYTYJFQXHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClF2N2O2/c14-12-11(20-9-7-13(15,16)8-9)10(1-2-17-12)18-3-5-19-6-4-18/h1-2,9H,3-8H2.
What are the key properties of 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine?
4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine has a molecular weight of 304.72 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-chloro-3-(3,3-difluorocyclobutyl)oxy-4-pyridinyl]morpholine is sourced from PubChem (CID 177233603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).