About 2-(4-ethylphenyl)-1,3-dimethylideneisoindole
2-(4-ethylphenyl)-1,3-dimethylideneisoindole (PubChem CID 177233701) has the molecular formula C18H17N
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1,3-dimethylideneisoindole.
Molecular Properties
| Compound Name | 2-(4-ethylphenyl)-1,3-dimethylideneisoindole |
| PubChem CID | 177233701 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-(4-ethylphenyl)-1,3-dimethylideneisoindole |
| SMILES | C=c1c2ccccc2c(=C)n1-c1ccc(CC)cc1 |
| InChI | InChI=1S/C18H17N/c1-4-15-9-11-16(12-10-15)19-13(2)17-7-5-6-8-18(17)14(19)3/h5-12H,2-4H2,1H3 |
| InChIKey | GUIMQMHTJTYGIB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-ethylphenyl)-1,3-dimethylideneisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylphenyl)-1,3-dimethylideneisoindole?
The IUPAC name of 2-(4-ethylphenyl)-1,3-dimethylideneisoindole (CID 177233701) is 2-(4-ethylphenyl)-1,3-dimethylideneisoindole.
What is the SMILES notation for 2-(4-ethylphenyl)-1,3-dimethylideneisoindole?
The canonical SMILES for 2-(4-ethylphenyl)-1,3-dimethylideneisoindole is C=c1c2ccccc2c(=C)n1-c1ccc(CC)cc1.
What is the InChIKey of 2-(4-ethylphenyl)-1,3-dimethylideneisoindole?
The InChIKey is GUIMQMHTJTYGIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N/c1-4-15-9-11-16(12-10-15)19-13(2)17-7-5-6-8-18(17)14(19)3/h5-12H,2-4H2,1H3.
What are the key properties of 2-(4-ethylphenyl)-1,3-dimethylideneisoindole?
2-(4-ethylphenyl)-1,3-dimethylideneisoindole has a molecular weight of 247.34 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylphenyl)-1,3-dimethylideneisoindole is sourced from PubChem (CID 177233701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).