About 3,4-bis(ethenyl)-2,5-dimethylidenefuran
3,4-bis(ethenyl)-2,5-dimethylidenefuran (PubChem CID 177233703) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-2,5-dimethylidenefuran.
Molecular Properties
| Compound Name | 3,4-bis(ethenyl)-2,5-dimethylidenefuran |
| PubChem CID | 177233703 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 3,4-bis(ethenyl)-2,5-dimethylidenefuran |
| SMILES | C=Cc1c(C=C)c(=C)oc1=C |
| InChI | InChI=1S/C10H10O/c1-5-9-7(3)11-8(4)10(9)6-2/h5-6H,1-4H2 |
| InChIKey | LTLWKYOUHZFYFT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-bis(ethenyl)-2,5-dimethylidenefuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(ethenyl)-2,5-dimethylidenefuran?
The IUPAC name of 3,4-bis(ethenyl)-2,5-dimethylidenefuran (CID 177233703) is 3,4-bis(ethenyl)-2,5-dimethylidenefuran.
What is the SMILES notation for 3,4-bis(ethenyl)-2,5-dimethylidenefuran?
The canonical SMILES for 3,4-bis(ethenyl)-2,5-dimethylidenefuran is C=Cc1c(C=C)c(=C)oc1=C.
What is the InChIKey of 3,4-bis(ethenyl)-2,5-dimethylidenefuran?
The InChIKey is LTLWKYOUHZFYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c1-5-9-7(3)11-8(4)10(9)6-2/h5-6H,1-4H2.
What are the key properties of 3,4-bis(ethenyl)-2,5-dimethylidenefuran?
3,4-bis(ethenyl)-2,5-dimethylidenefuran has a molecular weight of 146.19 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(ethenyl)-2,5-dimethylidenefuran is sourced from PubChem (CID 177233703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).