C21H19F3N4O6S — CID 177233757
methyl 5-[2-[(3R)-3-methylmorpholin-4-yl]-4-(trifluoromethylsulfonyloxy)-1,7-naphthyridin-8-yl]pyridine-2-carboxylate (PubChem CID 177233757) has the molecular formula C21H19F3N4O6S and a molecular weight of 512.47 g/mol. Its IUPAC name is methyl 5-[2-[(3R)-3-methylmorpholin-4-yl]-4-(trifluoromethylsulfonyloxy)-1,7-naphthyridin-8-yl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[2-[(3R)-3-methylmorpholin-4-yl]-4-(trifluoromethylsulfonyloxy)-1,7-naphthyridin-8-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 177233757 |
| Molecular Formula | C21H19F3N4O6S |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | methyl 5-[2-[(3R)-3-methylmorpholin-4-yl]-4-(trifluoromethylsulfonyloxy)-1,7-naphthyridin-8-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2nccc3c(OS(=O)(=O)C(F)(F)F)cc(N4CCOC[C@H]4C)nc23)cn1 |
| InChI | InChI=1S/C21H19F3N4O6S/c1-12-11-33-8-7-28(12)17-9-16(34-35(30,31)21(22,23)24)14-5-6-25-18(19(14)27-17)13-3-4-15(26-10-13)20(29)32-2/h3-6,9-10,12H,7-8,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | JFDMXBXZBUDGMA-GFCCVEGCSA-N |
| XLogP | 2.93 |
| TPSA | 120.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|