About 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide
6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide (PubChem CID 177233761) has the molecular formula C15H18N2O5
and a molecular weight of 306.32 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide.
Molecular Properties
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide |
| PubChem CID | 177233761 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide |
| SMILES | CN(C(=O)/C=C\C=O)C(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H18N2O5/c1-16(13(20)7-5-11-18)12(19)6-3-2-4-10-17-14(21)8-9-15(17)22/h5,7-9,11H,2-4,6,10H2,1H3/b7-5- |
| InChIKey | DNKXNMJCCFCARL-ALCCZGGFSA-N |
| XLogP | 0.21 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide?
The IUPAC name of 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide (CID 177233761) is 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide.
What is the SMILES notation for 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide?
The canonical SMILES for 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide is CN(C(=O)/C=C\C=O)C(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide?
The InChIKey is DNKXNMJCCFCARL-ALCCZGGFSA-N. The full InChI is InChI=1S/C15H18N2O5/c1-16(13(20)7-5-11-18)12(19)6-3-2-4-10-17-14(21)8-9-15(17)22/h5,7-9,11H,2-4,6,10H2,1H3/b7-5-.
What are the key properties of 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide?
6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide has a molecular weight of 306.32 g/mol, XLogP of 0.21, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dioxopyrrol-1-yl)-N-methyl-N-[(Z)-4-oxobut-2-enoyl]hexanamide is sourced from PubChem (CID 177233761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).