C24H29FN4O4 — CID 177234578
(2Z,3Z,5Z)-6-fluoro-N-methyl-5-[2-[(3-methyl-2-oxo-1H-pyrido[3,4-b][1,4]oxazin-7-yl)methyl]-3,6-dihydrooxazin-5-yl]-2-propylidenehepta-3,5-dienamide (PubChem CID 177234578) has the molecular formula C24H29FN4O4 and a molecular weight of 456.52 g/mol. Its IUPAC name is (2Z,3Z,5Z)-6-fluoro-N-methyl-5-[2-[(3-methyl-2-oxo-1H-pyrido[3,4-b][1,4]oxazin-7-yl)methyl]-3,6-dihydrooxazin-5-yl]-2-propylidenehepta-3,5-dienamide.
| Compound Name | (2Z,3Z,5Z)-6-fluoro-N-methyl-5-[2-[(3-methyl-2-oxo-1H-pyrido[3,4-b][1,4]oxazin-7-yl)methyl]-3,6-dihydrooxazin-5-yl]-2-propylidenehepta-3,5-dienamide |
|---|---|
| PubChem CID | 177234578 |
| Molecular Formula | C24H29FN4O4 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (2Z,3Z,5Z)-6-fluoro-N-methyl-5-[2-[(3-methyl-2-oxo-1H-pyrido[3,4-b][1,4]oxazin-7-yl)methyl]-3,6-dihydrooxazin-5-yl]-2-propylidenehepta-3,5-dienamide |
| SMILES | CC/C=C(/C=C\C(C1=CCN(Cc2cc3c(cn2)OC(C)C(=O)N3)OC1)=C(/C)F)C(=O)NC |
| InChI | InChI=1S/C24H29FN4O4/c1-5-6-17(24(31)26-4)7-8-20(15(2)25)18-9-10-29(32-14-18)13-19-11-21-22(12-27-19)33-16(3)23(30)28-21/h6-9,11-12,16H,5,10,13-14H2,1-4H3,(H,26,31)(H,28,30)/b8-7-,17-6-,20-15- |
| InChIKey | ATWRUCOLOGLOIK-CSUXXXTJSA-N |
| XLogP | 3.36 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|