About 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen
2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen (PubChem CID 177234583) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen.
Molecular Properties
| Compound Name | 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen |
| PubChem CID | 177234583 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen |
| SMILES | CCC1OC2=C(C=C(C=O)C(C)C2)NC1=O.[H][H] |
| InChI | InChI=1S/C12H15NO3.H2/c1-3-10-12(15)13-9-5-8(6-14)7(2)4-11(9)16-10;/h5-7,10H,3-4H2,1-2H3,(H,13,15);1H |
| InChIKey | XHMGXJMEZQUXOL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen?
The IUPAC name of 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen (CID 177234583) is 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen.
What is the SMILES notation for 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen?
The canonical SMILES for 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen is CCC1OC2=C(C=C(C=O)C(C)C2)NC1=O.[H][H].
What is the InChIKey of 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen?
The InChIKey is XHMGXJMEZQUXOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3.H2/c1-3-10-12(15)13-9-5-8(6-14)7(2)4-11(9)16-10;/h5-7,10H,3-4H2,1-2H3,(H,13,15);1H.
What are the key properties of 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen?
2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen has a molecular weight of 223.27 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-methyl-3-oxo-7,8-dihydro-4H-1,4-benzoxazine-6-carbaldehyde;molecular hydrogen is sourced from PubChem (CID 177234583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).