About 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium
2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium (PubChem CID 177234862) has the molecular formula C15H18NOY-
and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium.
Molecular Properties
| Compound Name | 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium |
| PubChem CID | 177234862 |
| Molecular Formula | C15H18NOY- |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium |
| SMILES | COC1=C(c2c[c-]c(C)cn2)C(C)CC(C)=C1.[Y] |
| InChI | InChI=1S/C15H18NO.Y/c1-10-5-6-13(16-9-10)15-12(3)7-11(2)8-14(15)17-4;/h6,8-9,12H,7H2,1-4H3;/q-1; |
| InChIKey | KVMACKZRVYPBIZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium?
The IUPAC name of 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium (CID 177234862) is 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium.
What is the SMILES notation for 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium?
The canonical SMILES for 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium is COC1=C(c2c[c-]c(C)cn2)C(C)CC(C)=C1.[Y].
What is the InChIKey of 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium?
The InChIKey is KVMACKZRVYPBIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18NO.Y/c1-10-5-6-13(16-9-10)15-12(3)7-11(2)8-14(15)17-4;/h6,8-9,12H,7H2,1-4H3;/q-1;.
What are the key properties of 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium?
2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium has a molecular weight of 317.22 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxy-4,6-dimethylcyclohexa-1,3-dien-1-yl)-5-methyl-4H-pyridin-4-ide;yttrium is sourced from PubChem (CID 177234862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).