About ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium
ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium (PubChem CID 177235139) has the molecular formula C15H23N2OY-
and a molecular weight of 336.27 g/mol. Its IUPAC name is ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium.
Molecular Properties
| Compound Name | ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium |
| PubChem CID | 177235139 |
| Molecular Formula | C15H23N2OY- |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium |
| SMILES | CC.[H]/N=C(\C=C/CC)Oc1c[c-]c(C(C)C)cn1.[Y] |
| InChI | InChI=1S/C13H17N2O.C2H6.Y/c1-4-5-6-12(14)16-13-8-7-11(9-15-13)10(2)3;1-2;/h5-6,8-10,14H,4H2,1-3H3;1-2H3;/q-1;;/b6-5-,14-12+;; |
| InChIKey | LBYQDESFGDTCCX-AIPRNVJESA-N |
| XLogP | 4.35 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium?
The IUPAC name of ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium (CID 177235139) is ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium.
What is the SMILES notation for ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium?
The canonical SMILES for ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium is CC.[H]/N=C(\C=C/CC)Oc1c[c-]c(C(C)C)cn1.[Y].
What is the InChIKey of ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium?
The InChIKey is LBYQDESFGDTCCX-AIPRNVJESA-N. The full InChI is InChI=1S/C13H17N2O.C2H6.Y/c1-4-5-6-12(14)16-13-8-7-11(9-15-13)10(2)3;1-2;/h5-6,8-10,14H,4H2,1-3H3;1-2H3;/q-1;;/b6-5-,14-12+;;.
What are the key properties of ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium?
ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium has a molecular weight of 336.27 g/mol, XLogP of 4.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5-propan-2-yl-4H-pyridin-4-id-2-yl) (Z)-pent-2-enimidate;yttrium is sourced from PubChem (CID 177235139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).